C43H88O4 — CID 142633562
2,2-bis(hydroxymethyl)-3-nonadecan-10-yl-4-nonyltridecane-1,3-diol (PubChem CID 142633562) has the molecular formula C43H88O4 and a molecular weight of 669.17 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)-3-nonadecan-10-yl-4-nonyltridecane-1,3-diol.
| Compound Name | 2,2-bis(hydroxymethyl)-3-nonadecan-10-yl-4-nonyltridecane-1,3-diol |
|---|---|
| PubChem CID | 142633562 |
| Molecular Formula | C43H88O4 |
| Molecular Weight | 669.17 g/mol |
| Exact Mass | 668.67 |
| IUPAC Name | 2,2-bis(hydroxymethyl)-3-nonadecan-10-yl-4-nonyltridecane-1,3-diol |
| SMILES | CCCCCCCCCC(CCCCCCCCC)C(O)(C(CCCCCCCCC)CCCCCCCCC)C(CO)(CO)CO |
| InChI | InChI=1S/C43H88O4/c1-5-9-13-17-21-25-29-33-40(34-30-26-22-18-14-10-6-2)43(47,42(37-44,38-45)39-46)41(35-31-27-23-19-15-11-7-3)36-32-28-24-20-16-12-8-4/h40-41,44-47H,5-39H2,1-4H3 |
| InChIKey | PDPZQCJCRZXRFV-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.17 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|