C28H26N2O4 — CID 142634290
N-[3-methoxy-4-[2-(2-oxoethenyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide (PubChem CID 142634290) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-[3-methoxy-4-[2-(2-oxoethenyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide.
| Compound Name | N-[3-methoxy-4-[2-(2-oxoethenyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 142634290 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-[3-methoxy-4-[2-(2-oxoethenyl)-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2C)ccc1C(=O)N1c2ccccc2CCCC1C=C=O |
| InChI | InChI=1S/C28H26N2O4/c1-19-8-3-5-12-23(19)27(32)29-21-14-15-24(26(18-21)34-2)28(33)30-22(16-17-31)11-7-10-20-9-4-6-13-25(20)30/h3-6,8-9,12-16,18,22H,7,10-11H2,1-2H3,(H,29,32) |
| InChIKey | WKXMNHUFGXSVTP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|