About decyl(phenoxy)azanium chloride
decyl(phenoxy)azanium chloride (PubChem CID 142634787) has the molecular formula C16H28ClNO
and a molecular weight of 285.86 g/mol. Its IUPAC name is decyl(phenoxy)azanium chloride.
Molecular Properties
| Compound Name | decyl(phenoxy)azanium chloride |
| PubChem CID | 142634787 |
| Molecular Formula | C16H28ClNO |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | decyl(phenoxy)azanium chloride |
| SMILES | CCCCCCCCCC[NH2+]Oc1ccccc1.[Cl-] |
| InChI | InChI=1S/C16H27NO.ClH/c1-2-3-4-5-6-7-8-12-15-17-18-16-13-10-9-11-14-16;/h9-11,13-14,17H,2-8,12,15H2,1H3;1H |
| InChIKey | DQJBUJGPXYJGOZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze decyl(phenoxy)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl(phenoxy)azanium chloride?
The IUPAC name of decyl(phenoxy)azanium chloride (CID 142634787) is decyl(phenoxy)azanium chloride.
What is the SMILES notation for decyl(phenoxy)azanium chloride?
The canonical SMILES for decyl(phenoxy)azanium chloride is CCCCCCCCCC[NH2+]Oc1ccccc1.[Cl-].
What is the InChIKey of decyl(phenoxy)azanium chloride?
The InChIKey is DQJBUJGPXYJGOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO.ClH/c1-2-3-4-5-6-7-8-12-15-17-18-16-13-10-9-11-14-16;/h9-11,13-14,17H,2-8,12,15H2,1H3;1H.
What are the key properties of decyl(phenoxy)azanium chloride?
decyl(phenoxy)azanium chloride has a molecular weight of 285.86 g/mol, XLogP of 0.69, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for decyl(phenoxy)azanium chloride is sourced from PubChem (CID 142634787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).