benzhydryl(octyl)azanium chloride

C21H30ClN — CID 88728655

IUPACbenzhydryl(octyl)azanium chloride
SMILESCCCCCCCC[NH2+]C(c1ccccc1)c1ccccc1.[Cl-]
InChIInChI=1S/C21H29N.ClH/c1-2-3-4-5-6-13-18-22-21(19-14-9-7-10-15-19)20-16-11-8-12-17-20;/h7-12,14-17,21-22H,2-6,13,18H2,1H3;1H
InChIKeyWOPVFVQSNNAUQR-UHFFFAOYSA-N
MW331.93 g/mol
LogP1.70
Rot. Bonds10

About benzhydryl(octyl)azanium chloride

benzhydryl(octyl)azanium chloride (PubChem CID 88728655) has the molecular formula C21H30ClN and a molecular weight of 331.93 g/mol. Its IUPAC name is benzhydryl(octyl)azanium chloride.

Molecular Properties

Compound Namebenzhydryl(octyl)azanium chloride
PubChem CID88728655
Molecular FormulaC21H30ClN
Molecular Weight331.93 g/mol
Exact Mass331.21
IUPAC Namebenzhydryl(octyl)azanium chloride
SMILESCCCCCCCC[NH2+]C(c1ccccc1)c1ccccc1.[Cl-]
InChIInChI=1S/C21H29N.ClH/c1-2-3-4-5-6-13-18-22-21(19-14-9-7-10-15-19)20-16-11-8-12-17-20;/h7-12,14-17,21-22H,2-6,13,18H2,1H3;1H
InChIKeyWOPVFVQSNNAUQR-UHFFFAOYSA-N
XLogP1.70
TPSA16.61 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds10
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.93
LogP ≤ 51.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze benzhydryl(octyl)azanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

benzhydryl(octadecyl)azanium chloride
CID 88728255
[(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]-tetradecylazanium chloride
CID 24936125
2,2-diphenylethyl(pentyl)azanium chloride
CID 70520335
3,3-diphenylpropyl(hexyl)azanium hydroxide
CID 70585030
icosan-10-ylbenzene
CID 54351357
hentriacontan-13-ylbenzene
CID 91306613
(1R)-1-phenyloctan-1-ol
CID 12794259
azane;benzhydryl-hexadecyl-dimethylazanium;chloride;hydrochloride
CID 174564822
octadecyl(2-phenylethyl)azanium chloride
CID 21249615
decyl(phenoxy)azanium chloride
CID 142634787
dimethyl(1-phenylnonadecyl)azanium chloride
CID 22178529
(1-bromo-2-methylnonyl)benzene
CID 104846505

Frequently Asked Questions

What is the IUPAC name of benzhydryl(octyl)azanium chloride?
The IUPAC name of benzhydryl(octyl)azanium chloride (CID 88728655) is benzhydryl(octyl)azanium chloride.
What is the SMILES notation for benzhydryl(octyl)azanium chloride?
The canonical SMILES for benzhydryl(octyl)azanium chloride is CCCCCCCC[NH2+]C(c1ccccc1)c1ccccc1.[Cl-].
What is the InChIKey of benzhydryl(octyl)azanium chloride?
The InChIKey is WOPVFVQSNNAUQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N.ClH/c1-2-3-4-5-6-13-18-22-21(19-14-9-7-10-15-19)20-16-11-8-12-17-20;/h7-12,14-17,21-22H,2-6,13,18H2,1H3;1H.
What are the key properties of benzhydryl(octyl)azanium chloride?
benzhydryl(octyl)azanium chloride has a molecular weight of 331.93 g/mol, XLogP of 1.70, 10 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydryl(octyl)azanium chloride is sourced from PubChem (CID 88728655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).