C21H31NO — CID 70585030
3,3-diphenylpropyl(hexyl)azanium hydroxide (PubChem CID 70585030) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is 3,3-diphenylpropyl(hexyl)azanium hydroxide.
| Compound Name | 3,3-diphenylpropyl(hexyl)azanium hydroxide |
|---|---|
| PubChem CID | 70585030 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 3,3-diphenylpropyl(hexyl)azanium hydroxide |
| SMILES | CCCCCC[NH2+]CCC(c1ccccc1)c1ccccc1.[OH-] |
| InChI | InChI=1S/C21H29N.H2O/c1-2-3-4-11-17-22-18-16-21(19-12-7-5-8-13-19)20-14-9-6-10-15-20;/h5-10,12-15,21-22H,2-4,11,16-18H2,1H3;1H2 |
| InChIKey | GZLCDSKQPHNIFZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|