C20H26ClNOSi — CID 142636529
N-(4-chlorophenyl)-4-methyl-3-(1-trimethylsilylpropan-2-yl)benzamide (PubChem CID 142636529) has the molecular formula C20H26ClNOSi and a molecular weight of 359.97 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-methyl-3-(1-trimethylsilylpropan-2-yl)benzamide.
| Compound Name | N-(4-chlorophenyl)-4-methyl-3-(1-trimethylsilylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 142636529 |
| Molecular Formula | C20H26ClNOSi |
| Molecular Weight | 359.97 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-(4-chlorophenyl)-4-methyl-3-(1-trimethylsilylpropan-2-yl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Cl)cc2)cc1C(C)C[Si](C)(C)C |
| InChI | InChI=1S/C20H26ClNOSi/c1-14-6-7-16(12-19(14)15(2)13-24(3,4)5)20(23)22-18-10-8-17(21)9-11-18/h6-12,15H,13H2,1-5H3,(H,22,23) |
| InChIKey | VPSBMTOPCYWBDD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.97 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|