C17H27NO3 — CID 142638548
1-(3-amino-2-hydroxyphenyl)-2-tert-butyl-2-(hydroxymethyl)-3,3-dimethylbutan-1-one (PubChem CID 142638548) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(3-amino-2-hydroxyphenyl)-2-tert-butyl-2-(hydroxymethyl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(3-amino-2-hydroxyphenyl)-2-tert-butyl-2-(hydroxymethyl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 142638548 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-(3-amino-2-hydroxyphenyl)-2-tert-butyl-2-(hydroxymethyl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)C(CO)(C(=O)c1cccc(N)c1O)C(C)(C)C |
| InChI | InChI=1S/C17H27NO3/c1-15(2,3)17(10-19,16(4,5)6)14(21)11-8-7-9-12(18)13(11)20/h7-9,19-20H,10,18H2,1-6H3 |
| InChIKey | MOHKFVGFOKCIOG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|