C15H24O5 — CID 142641323
methyl 3-[1-hydroxy-5-(5-hydroxypentoxy)cyclohexa-2,4-dien-1-yl]propanoate (PubChem CID 142641323) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is methyl 3-[1-hydroxy-5-(5-hydroxypentoxy)cyclohexa-2,4-dien-1-yl]propanoate.
| Compound Name | methyl 3-[1-hydroxy-5-(5-hydroxypentoxy)cyclohexa-2,4-dien-1-yl]propanoate |
|---|---|
| PubChem CID | 142641323 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | methyl 3-[1-hydroxy-5-(5-hydroxypentoxy)cyclohexa-2,4-dien-1-yl]propanoate |
| SMILES | COC(=O)CCC1(O)C=CC=C(OCCCCCO)C1 |
| InChI | InChI=1S/C15H24O5/c1-19-14(17)7-9-15(18)8-5-6-13(12-15)20-11-4-2-3-10-16/h5-6,8,16,18H,2-4,7,9-12H2,1H3 |
| InChIKey | ZOQNVHCQRIDSFY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|