About methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate
methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate (PubChem CID 71219273) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate.
Molecular Properties
| Compound Name | methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate |
| PubChem CID | 71219273 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate |
| SMILES | COC(=O)CCCOC1=CC=CC(C)C1 |
| InChI | InChI=1S/C12H18O3/c1-10-5-3-6-11(9-10)15-8-4-7-12(13)14-2/h3,5-6,10H,4,7-9H2,1-2H3 |
| InChIKey | BPACYDXQMCKIEF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate?
The IUPAC name of methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate (CID 71219273) is methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate.
What is the SMILES notation for methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate?
The canonical SMILES for methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate is COC(=O)CCCOC1=CC=CC(C)C1.
What is the InChIKey of methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate?
The InChIKey is BPACYDXQMCKIEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-10-5-3-6-11(9-10)15-8-4-7-12(13)14-2/h3,5-6,10H,4,7-9H2,1-2H3.
What are the key properties of methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate?
methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate has a molecular weight of 210.27 g/mol, XLogP of 2.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-methylcyclohexa-1,3-dien-1-yl)oxybutanoate is sourced from PubChem (CID 71219273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).