C13H7N5O2S — CID 142642131
12-pyridin-3-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione (PubChem CID 142642131) has the molecular formula C13H7N5O2S and a molecular weight of 297.30 g/mol. Its IUPAC name is 12-pyridin-3-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione.
| Compound Name | 12-pyridin-3-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
|---|---|
| PubChem CID | 142642131 |
| Molecular Formula | C13H7N5O2S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 12-pyridin-3-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
| SMILES | O=c1[nH]c(=O)c2sc3ncc(-c4cccnc4)nc3c2[nH]1 |
| InChI | InChI=1S/C13H7N5O2S/c19-11-10-8(17-13(20)18-11)9-12(21-10)15-5-7(16-9)6-2-1-3-14-4-6/h1-5H,(H2,17,18,19,20) |
| InChIKey | DSQYHBWYLWCXCJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |