C7H8N4OS — CID 142642485
(5R)-3-(2H-triazol-4-yl)-4-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 142642485) has the molecular formula C7H8N4OS and a molecular weight of 196.23 g/mol. Its IUPAC name is (5R)-3-(2H-triazol-4-yl)-4-thia-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (5R)-3-(2H-triazol-4-yl)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 142642485 |
| Molecular Formula | C7H8N4OS |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (5R)-3-(2H-triazol-4-yl)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | O=C1C[C@H]2SC(c3cn[nH]n3)CN12 |
| InChI | InChI=1S/C7H8N4OS/c12-6-1-7-11(6)3-5(13-7)4-2-8-10-9-4/h2,5,7H,1,3H2,(H,8,9,10)/t5?,7-/m1/s1 |
| InChIKey | OFVVMKJRHNOMRK-NQPNHJOESA-N |
| XLogP | 0.15 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |