C6H8ClNOS — CID 70593181
(3S,5R)-3-(chloromethyl)-4-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 70593181) has the molecular formula C6H8ClNOS and a molecular weight of 177.66 g/mol. Its IUPAC name is (3S,5R)-3-(chloromethyl)-4-thia-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (3S,5R)-3-(chloromethyl)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 70593181 |
| Molecular Formula | C6H8ClNOS |
| Molecular Weight | 177.66 g/mol |
| Exact Mass | 177.00 |
| IUPAC Name | (3S,5R)-3-(chloromethyl)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | O=C1C[C@H]2S[C@H](CCl)CN12 |
| InChI | InChI=1S/C6H8ClNOS/c7-2-4-3-8-5(9)1-6(8)10-4/h4,6H,1-3H2/t4-,6-/m1/s1 |
| InChIKey | RXADAPFKFFKNOM-INEUFUBQSA-N |
| XLogP | 0.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.66 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|