C7H9ClN4OS — CID 168509740
1-(5-amino-1,3,4-thiadiazol-2-yl)-4-(chloromethyl)pyrrolidin-2-one (PubChem CID 168509740) has the molecular formula C7H9ClN4OS and a molecular weight of 232.70 g/mol. Its IUPAC name is 1-(5-amino-1,3,4-thiadiazol-2-yl)-4-(chloromethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-amino-1,3,4-thiadiazol-2-yl)-4-(chloromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168509740 |
| Molecular Formula | C7H9ClN4OS |
| Molecular Weight | 232.70 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 1-(5-amino-1,3,4-thiadiazol-2-yl)-4-(chloromethyl)pyrrolidin-2-one |
| SMILES | Nc1nnc(N2CC(CCl)CC2=O)s1 |
| InChI | InChI=1S/C7H9ClN4OS/c8-2-4-1-5(13)12(3-4)7-11-10-6(9)14-7/h4H,1-3H2,(H2,9,10) |
| InChIKey | IGTWGIMJEPUTOK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.70 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|