C11H14ClN3OS — CID 168509610
4-(chloromethyl)-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyrrolidin-2-one (PubChem CID 168509610) has the molecular formula C11H14ClN3OS and a molecular weight of 271.77 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168509610 |
| Molecular Formula | C11H14ClN3OS |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 4-(chloromethyl)-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CC(CCl)CN1c1nc2c(s1)CNCC2 |
| InChI | InChI=1S/C11H14ClN3OS/c12-4-7-3-10(16)15(6-7)11-14-8-1-2-13-5-9(8)17-11/h7,13H,1-6H2 |
| InChIKey | YFCZDFUNBIMWEA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|