C40H51N5O7 — CID 142642760
3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]-3-[(4-methoxyphenyl)methyl]-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-one (PubChem CID 142642760) has the molecular formula C40H51N5O7 and a molecular weight of 713.88 g/mol. Its IUPAC name is 3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]-3-[(4-methoxyphenyl)methyl]-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-one.
| Compound Name | 3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]-3-[(4-methoxyphenyl)methyl]-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 142642760 |
| Molecular Formula | C40H51N5O7 |
| Molecular Weight | 713.88 g/mol |
| Exact Mass | 713.38 |
| IUPAC Name | 3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]-3-[(4-methoxyphenyl)methyl]-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-one |
| SMILES | CCOCCn1c(N2CCCN(CCC3(Cc4ccc(OC)cc4)CCN(C(=O)c4cc(OC)c(OC)c(OC)c4)C3=O)CC2)nc2ccccc21 |
| InChI | InChI=1S/C40H51N5O7/c1-6-52-25-24-44-33-11-8-7-10-32(33)41-39(44)43-19-9-18-42(22-23-43)20-16-40(28-29-12-14-31(48-2)15-13-29)17-21-45(38(40)47)37(46)30-26-34(49-3)36(51-5)35(27-30)50-4/h7-8,10-15,26-27H,6,9,16-25,28H2,1-5H3 |
| InChIKey | OAADMPRVPPRIAU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 107.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.88 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|