C16H15N3O3S — CID 1426430
ethyl (2R)-2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)propanoate (PubChem CID 1426430) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is ethyl (2R)-2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)propanoate.
| Compound Name | ethyl (2R)-2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)propanoate |
|---|---|
| PubChem CID | 1426430 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | ethyl (2R)-2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)propanoate |
| SMILES | CCOC(=O)[C@@H](C)n1nnc2sc(-c3ccccc3)cc2c1=O |
| InChI | InChI=1S/C16H15N3O3S/c1-3-22-16(21)10(2)19-15(20)12-9-13(23-14(12)17-18-19)11-7-5-4-6-8-11/h4-10H,3H2,1-2H3/t10-/m1/s1 |
| InChIKey | UGVOIQMMDMPCRZ-SNVBAGLBSA-N |
| XLogP | 2.64 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |