About 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate
2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate (PubChem CID 1426420) has the molecular formula C17H17N3O3S
and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate |
| PubChem CID | 1426420 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate |
| SMILES | CC(C)COC(=O)Cn1nnc2sc(-c3ccccc3)cc2c1=O |
| InChI | InChI=1S/C17H17N3O3S/c1-11(2)10-23-15(21)9-20-17(22)13-8-14(24-16(13)18-19-20)12-6-4-3-5-7-12/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | AXHGMNFQJDXGEC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate?
The IUPAC name of 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate (CID 1426420) is 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate.
What is the SMILES notation for 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate?
The canonical SMILES for 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate is CC(C)COC(=O)Cn1nnc2sc(-c3ccccc3)cc2c1=O.
What is the InChIKey of 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate?
The InChIKey is AXHGMNFQJDXGEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O3S/c1-11(2)10-23-15(21)9-20-17(22)13-8-14(24-16(13)18-19-20)12-6-4-3-5-7-12/h3-8,11H,9-10H2,1-2H3.
What are the key properties of 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate?
2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate has a molecular weight of 343.41 g/mol, XLogP of 2.72, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-(4-oxo-6-phenylthieno[2,3-d]triazin-3-yl)acetate is sourced from PubChem (CID 1426420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).