C18H12N4O3S — CID 7453956
3-[(4-nitrophenyl)methyl]-6-phenylthieno[2,3-d]triazin-4-one (PubChem CID 7453956) has the molecular formula C18H12N4O3S and a molecular weight of 364.39 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)methyl]-6-phenylthieno[2,3-d]triazin-4-one.
| Compound Name | 3-[(4-nitrophenyl)methyl]-6-phenylthieno[2,3-d]triazin-4-one |
|---|---|
| PubChem CID | 7453956 |
| Molecular Formula | C18H12N4O3S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 3-[(4-nitrophenyl)methyl]-6-phenylthieno[2,3-d]triazin-4-one |
| SMILES | O=c1c2cc(-c3ccccc3)sc2nnn1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H12N4O3S/c23-18-15-10-16(13-4-2-1-3-5-13)26-17(15)19-20-21(18)11-12-6-8-14(9-7-12)22(24)25/h1-10H,11H2 |
| InChIKey | QXPQSFDUUDNPFK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|