C24H20ClN3O2 — CID 142644221
3-(2-chlorophenyl)-2-[(E)-2-[6-(ethoxymethyl)-2-pyridinyl]ethenyl]quinazolin-4-one (PubChem CID 142644221) has the molecular formula C24H20ClN3O2 and a molecular weight of 417.90 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-2-[(E)-2-[6-(ethoxymethyl)-2-pyridinyl]ethenyl]quinazolin-4-one.
| Compound Name | 3-(2-chlorophenyl)-2-[(E)-2-[6-(ethoxymethyl)-2-pyridinyl]ethenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 142644221 |
| Molecular Formula | C24H20ClN3O2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-(2-chlorophenyl)-2-[(E)-2-[6-(ethoxymethyl)-2-pyridinyl]ethenyl]quinazolin-4-one |
| SMILES | CCOCc1cccc(/C=C/c2nc3ccccc3c(=O)n2-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C24H20ClN3O2/c1-2-30-16-18-9-7-8-17(26-18)14-15-23-27-21-12-5-3-10-19(21)24(29)28(23)22-13-6-4-11-20(22)25/h3-15H,2,16H2,1H3/b15-14+ |
| InChIKey | KVNSBUQIDJUEKN-CCEZHUSRSA-N |
| XLogP | 5.14 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |