C27H28ClFN4O4S — CID 85056745
3-(2-chlorophenyl)-2-[2-[6-(diethylaminomethyl)-2-pyridinyl]ethenyl]-6-fluoroquinazolin-4-one;methanesulfonic acid (PubChem CID 85056745) has the molecular formula C27H28ClFN4O4S and a molecular weight of 559.06 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-2-[2-[6-(diethylaminomethyl)-2-pyridinyl]ethenyl]-6-fluoroquinazolin-4-one;methanesulfonic acid.
| Compound Name | 3-(2-chlorophenyl)-2-[2-[6-(diethylaminomethyl)-2-pyridinyl]ethenyl]-6-fluoroquinazolin-4-one;methanesulfonic acid |
|---|---|
| PubChem CID | 85056745 |
| Molecular Formula | C27H28ClFN4O4S |
| Molecular Weight | 559.06 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 3-(2-chlorophenyl)-2-[2-[6-(diethylaminomethyl)-2-pyridinyl]ethenyl]-6-fluoroquinazolin-4-one;methanesulfonic acid |
| SMILES | CCN(CC)Cc1cccc(C=Cc2nc3ccc(F)cc3c(=O)n2-c2ccccc2Cl)n1.CS(=O)(=O)O |
| InChI | InChI=1S/C26H24ClFN4O.CH4O3S/c1-3-31(4-2)17-20-9-7-8-19(29-20)13-15-25-30-23-14-12-18(28)16-21(23)26(33)32(25)24-11-6-5-10-22(24)27;1-5(2,3)4/h5-16H,3-4,17H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | PKFGVOXCLHSEBR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.06 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|