C22H15ClFN3O2 — CID 177462706
3-(2-chlorophenyl)-6-fluoro-2-[(E)-2-hydroxy-2-(6-methyl-2-pyridinyl)ethenyl]quinazolin-4-one (PubChem CID 177462706) has the molecular formula C22H15ClFN3O2 and a molecular weight of 407.83 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-6-fluoro-2-[(E)-2-hydroxy-2-(6-methyl-2-pyridinyl)ethenyl]quinazolin-4-one.
| Compound Name | 3-(2-chlorophenyl)-6-fluoro-2-[(E)-2-hydroxy-2-(6-methyl-2-pyridinyl)ethenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 177462706 |
| Molecular Formula | C22H15ClFN3O2 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 3-(2-chlorophenyl)-6-fluoro-2-[(E)-2-hydroxy-2-(6-methyl-2-pyridinyl)ethenyl]quinazolin-4-one |
| SMILES | Cc1cccc(/C(O)=C\c2nc3ccc(F)cc3c(=O)n2-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C22H15ClFN3O2/c1-13-5-4-7-18(25-13)20(28)12-21-26-17-10-9-14(24)11-15(17)22(29)27(21)19-8-3-2-6-16(19)23/h2-12,28H,1H3/b20-12+ |
| InChIKey | FJPAXJFPIARBRC-UDWIEESQSA-N |
| XLogP | 4.94 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|