C11H17NO5S — CID 14264453
dipropan-2-yl (2R,3S)-2-hydroxy-3-thiocyanatobutanedioate (PubChem CID 14264453) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is dipropan-2-yl (2R,3S)-2-hydroxy-3-thiocyanatobutanedioate.
| Compound Name | dipropan-2-yl (2R,3S)-2-hydroxy-3-thiocyanatobutanedioate |
|---|---|
| PubChem CID | 14264453 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | dipropan-2-yl (2R,3S)-2-hydroxy-3-thiocyanatobutanedioate |
| SMILES | CC(C)OC(=O)[C@@H](O)[C@H](SC#N)C(=O)OC(C)C |
| InChI | InChI=1S/C11H17NO5S/c1-6(2)16-10(14)8(13)9(18-5-12)11(15)17-7(3)4/h6-9,13H,1-4H3/t8-,9-/m0/s1 |
| InChIKey | OZEQMMLMFODDOI-IUCAKERBSA-N |
| XLogP | 0.83 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|