C10H14O7S — CID 18655193
(2S)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxybutanedioic acid (PubChem CID 18655193) has the molecular formula C10H14O7S and a molecular weight of 278.28 g/mol. Its IUPAC name is (2S)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxybutanedioic acid.
| Compound Name | (2S)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxybutanedioic acid |
|---|---|
| PubChem CID | 18655193 |
| Molecular Formula | C10H14O7S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (2S)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxybutanedioic acid |
| SMILES | CC(=O)SC[C@@H](C)C(=O)O[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H14O7S/c1-5(4-18-6(2)11)10(16)17-7(9(14)15)3-8(12)13/h5,7H,3-4H2,1-2H3,(H,12,13)(H,14,15)/t5-,7+/m1/s1 |
| InChIKey | ODEAQSHMORRBIE-VDTYLAMSSA-N |
| XLogP | 0.37 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|