C8H12O6S — CID 18655150
(2S)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxybutanedioic acid (PubChem CID 18655150) has the molecular formula C8H12O6S and a molecular weight of 236.24 g/mol. Its IUPAC name is (2S)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxybutanedioic acid.
| Compound Name | (2S)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxybutanedioic acid |
|---|---|
| PubChem CID | 18655150 |
| Molecular Formula | C8H12O6S |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (2S)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxybutanedioic acid |
| SMILES | C[C@H](CS)C(=O)O[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12O6S/c1-4(3-15)8(13)14-5(7(11)12)2-6(9)10/h4-5,15H,2-3H2,1H3,(H,9,10)(H,11,12)/t4-,5+/m1/s1 |
| InChIKey | LIJRRESAHQIXAC-UHNVWZDZSA-N |
| XLogP | 0.02 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|