C12H20O6S — CID 18655153
(2S)-3-(2,2-dimethylpropanoyloxy)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxypropanoic acid (PubChem CID 18655153) has the molecular formula C12H20O6S and a molecular weight of 292.35 g/mol. Its IUPAC name is (2S)-3-(2,2-dimethylpropanoyloxy)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxypropanoic acid.
| Compound Name | (2S)-3-(2,2-dimethylpropanoyloxy)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 18655153 |
| Molecular Formula | C12H20O6S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (2S)-3-(2,2-dimethylpropanoyloxy)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxypropanoic acid |
| SMILES | C[C@H](CS)C(=O)O[C@@H](COC(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H20O6S/c1-7(6-19)10(15)18-8(9(13)14)5-17-11(16)12(2,3)4/h7-8,19H,5-6H2,1-4H3,(H,13,14)/t7-,8+/m1/s1 |
| InChIKey | ICSRDDYAIXYFTG-SFYZADRCSA-N |
| XLogP | 1.14 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|