C8H14O5S — CID 18655137
(2S)-3-methoxy-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxypropanoic acid (PubChem CID 18655137) has the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. Its IUPAC name is (2S)-3-methoxy-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxypropanoic acid.
| Compound Name | (2S)-3-methoxy-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 18655137 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (2S)-3-methoxy-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxypropanoic acid |
| SMILES | COC[C@H](OC(=O)[C@H](C)CS)C(=O)O |
| InChI | InChI=1S/C8H14O5S/c1-5(4-14)8(11)13-6(3-12-2)7(9)10/h5-6,14H,3-4H2,1-2H3,(H,9,10)/t5-,6+/m1/s1 |
| InChIKey | YDQSVMOGEWSMPK-RITPCOANSA-N |
| XLogP | 0.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|