C9H14O6S — CID 18655182
(2S)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-hydroxypropanoic acid (PubChem CID 18655182) has the molecular formula C9H14O6S and a molecular weight of 250.27 g/mol. Its IUPAC name is (2S)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18655182 |
| Molecular Formula | C9H14O6S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | (2S)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-hydroxypropanoic acid |
| SMILES | CC(=O)SC[C@@H](C)C(=O)O[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C9H14O6S/c1-5(4-16-6(2)11)9(14)15-7(3-10)8(12)13/h5,7,10H,3-4H2,1-2H3,(H,12,13)/t5-,7+/m1/s1 |
| InChIKey | MTTCOPGMNVLQIV-VDTYLAMSSA-N |
| XLogP | -0.11 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|