C14H24O5S2 — CID 10337106
(2R)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-pentan-3-ylsulfanylpropanoic acid (PubChem CID 10337106) has the molecular formula C14H24O5S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is (2R)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-pentan-3-ylsulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-pentan-3-ylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 10337106 |
| Molecular Formula | C14H24O5S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2R)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-pentan-3-ylsulfanylpropanoic acid |
| SMILES | CCC(CC)SC[C@H](OC(=O)[C@H](C)CSC(C)=O)C(=O)O |
| InChI | InChI=1S/C14H24O5S2/c1-5-11(6-2)21-8-12(13(16)17)19-14(18)9(3)7-20-10(4)15/h9,11-12H,5-8H2,1-4H3,(H,16,17)/t9-,12+/m1/s1 |
| InChIKey | MQVAAMYOLCGIBS-SKDRFNHKSA-N |
| XLogP | 2.82 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|