C9H13F3O4S2 — CID 18655130
(2R)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxy-3-(2,2,2-trifluoroethylsulfanyl)propanoic acid (PubChem CID 18655130) has the molecular formula C9H13F3O4S2 and a molecular weight of 306.33 g/mol. Its IUPAC name is (2R)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxy-3-(2,2,2-trifluoroethylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxy-3-(2,2,2-trifluoroethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 18655130 |
| Molecular Formula | C9H13F3O4S2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | (2R)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxy-3-(2,2,2-trifluoroethylsulfanyl)propanoic acid |
| SMILES | C[C@H](CS)C(=O)O[C@@H](CSCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H13F3O4S2/c1-5(2-17)8(15)16-6(7(13)14)3-18-4-9(10,11)12/h5-6,17H,2-4H2,1H3,(H,13,14)/t5-,6+/m1/s1 |
| InChIKey | YYVKAZFKLHKCKV-RITPCOANSA-N |
| XLogP | 1.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|