C12H20O5S2 — CID 10447999
(2R)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-propan-2-ylsulfanylpropanoic acid (PubChem CID 10447999) has the molecular formula C12H20O5S2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (2R)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-propan-2-ylsulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-propan-2-ylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 10447999 |
| Molecular Formula | C12H20O5S2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (2R)-2-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]oxy-3-propan-2-ylsulfanylpropanoic acid |
| SMILES | CC(=O)SC[C@@H](C)C(=O)O[C@@H](CSC(C)C)C(=O)O |
| InChI | InChI=1S/C12H20O5S2/c1-7(2)18-6-10(11(14)15)17-12(16)8(3)5-19-9(4)13/h7-8,10H,5-6H2,1-4H3,(H,14,15)/t8-,10+/m1/s1 |
| InChIKey | QHPQTWJEHHBCIA-SCZZXKLOSA-N |
| XLogP | 2.04 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|