C22H23BrN2O3 — CID 142644692
(2S)-2-bromo-N-(6-oxo-1,3,4,7,8,12b-hexahydro-[1,4]oxazino[3,4-a][2]benzazepin-7-yl)-3-phenylpropanamide (PubChem CID 142644692) has the molecular formula C22H23BrN2O3 and a molecular weight of 443.34 g/mol. Its IUPAC name is (2S)-2-bromo-N-(6-oxo-1,3,4,7,8,12b-hexahydro-[1,4]oxazino[3,4-a][2]benzazepin-7-yl)-3-phenylpropanamide.
| Compound Name | (2S)-2-bromo-N-(6-oxo-1,3,4,7,8,12b-hexahydro-[1,4]oxazino[3,4-a][2]benzazepin-7-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 142644692 |
| Molecular Formula | C22H23BrN2O3 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (2S)-2-bromo-N-(6-oxo-1,3,4,7,8,12b-hexahydro-[1,4]oxazino[3,4-a][2]benzazepin-7-yl)-3-phenylpropanamide |
| SMILES | O=C(NC1Cc2ccccc2C2COCCN2C1=O)[C@@H](Br)Cc1ccccc1 |
| InChI | InChI=1S/C22H23BrN2O3/c23-18(12-15-6-2-1-3-7-15)21(26)24-19-13-16-8-4-5-9-17(16)20-14-28-11-10-25(20)22(19)27/h1-9,18-20H,10-14H2,(H,24,26)/t18-,19?,20?/m0/s1 |
| InChIKey | YYBJNPMDZRDTNH-HDYDNRTBSA-N |
| XLogP | 2.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|