C42H81NO4 — CID 142645267
ethyl N-[1,3-bis[(Z)-octadec-9-enoxy]propan-2-yl]carbamate (PubChem CID 142645267) has the molecular formula C42H81NO4 and a molecular weight of 664.11 g/mol. Its IUPAC name is ethyl N-[1,3-bis[(Z)-octadec-9-enoxy]propan-2-yl]carbamate.
| Compound Name | ethyl N-[1,3-bis[(Z)-octadec-9-enoxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 142645267 |
| Molecular Formula | C42H81NO4 |
| Molecular Weight | 664.11 g/mol |
| Exact Mass | 663.62 |
| IUPAC Name | ethyl N-[1,3-bis[(Z)-octadec-9-enoxy]propan-2-yl]carbamate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(COCCCCCCCC/C=C\CCCCCCCC)NC(=O)OCC |
| InChI | InChI=1S/C42H81NO4/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-45-39-41(43-42(44)47-6-3)40-46-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h19-22,41H,4-18,23-40H2,1-3H3,(H,43,44)/b21-19-,22-20- |
| InChIKey | NPXHRCQBFZOHBJ-WRBBJXAJSA-N |
| XLogP | 13.21 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.11 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|