C16H23N3O5 — CID 142645746
tert-butyl N-[(2S,3R)-4-amino-3-benzyl-1-(hydroxyamino)-1,4-dioxobutan-2-yl]carbamate (PubChem CID 142645746) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-4-amino-3-benzyl-1-(hydroxyamino)-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-4-amino-3-benzyl-1-(hydroxyamino)-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142645746 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | tert-butyl N-[(2S,3R)-4-amino-3-benzyl-1-(hydroxyamino)-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)NO)[C@@H](Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C16H23N3O5/c1-16(2,3)24-15(22)18-12(14(21)19-23)11(13(17)20)9-10-7-5-4-6-8-10/h4-8,11-12,23H,9H2,1-3H3,(H2,17,20)(H,18,22)(H,19,21)/t11-,12+/m1/s1 |
| InChIKey | ACROEOMYSCEUKW-NEPJUHHUSA-N |
| XLogP | 0.73 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|