About 2,5-dioxabicyclo[2.2.2]octane-1,6-diol
2,5-dioxabicyclo[2.2.2]octane-1,6-diol (PubChem CID 142646090) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is 2,5-dioxabicyclo[2.2.2]octane-1,6-diol.
Molecular Properties
| Compound Name | 2,5-dioxabicyclo[2.2.2]octane-1,6-diol |
| PubChem CID | 142646090 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2,5-dioxabicyclo[2.2.2]octane-1,6-diol |
| SMILES | OC1OC2CCC1(O)OC2 |
| InChI | InChI=1S/C6H10O4/c7-5-6(8)2-1-4(10-5)3-9-6/h4-5,7-8H,1-3H2 |
| InChIKey | CPTBQGSVCBQUFU-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dioxabicyclo[2.2.2]octane-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dioxabicyclo[2.2.2]octane-1,6-diol?
The IUPAC name of 2,5-dioxabicyclo[2.2.2]octane-1,6-diol (CID 142646090) is 2,5-dioxabicyclo[2.2.2]octane-1,6-diol.
What is the SMILES notation for 2,5-dioxabicyclo[2.2.2]octane-1,6-diol?
The canonical SMILES for 2,5-dioxabicyclo[2.2.2]octane-1,6-diol is OC1OC2CCC1(O)OC2.
What is the InChIKey of 2,5-dioxabicyclo[2.2.2]octane-1,6-diol?
The InChIKey is CPTBQGSVCBQUFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c7-5-6(8)2-1-4(10-5)3-9-6/h4-5,7-8H,1-3H2.
What are the key properties of 2,5-dioxabicyclo[2.2.2]octane-1,6-diol?
2,5-dioxabicyclo[2.2.2]octane-1,6-diol has a molecular weight of 146.14 g/mol, XLogP of -0.80, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dioxabicyclo[2.2.2]octane-1,6-diol is sourced from PubChem (CID 142646090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).