C6F10S — CID 14264796
2-fluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2-(trifluoromethyl)thiirane (PubChem CID 14264796) has the molecular formula C6F10S and a molecular weight of 294.11 g/mol. Its IUPAC name is 2-fluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2-(trifluoromethyl)thiirane.
| Compound Name | 2-fluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2-(trifluoromethyl)thiirane |
|---|---|
| PubChem CID | 14264796 |
| Molecular Formula | C6F10S |
| Molecular Weight | 294.11 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 2-fluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2-(trifluoromethyl)thiirane |
| SMILES | FC(F)(F)C(=C1SC1(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F10S/c7-3(6(14,15)16)2(17-3)1(4(8,9)10)5(11,12)13 |
| InChIKey | UVYBMOLSINZCBJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.11 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|