C7F12S — CID 23234849
3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,2-bis(trifluoromethyl)thiirane (PubChem CID 23234849) has the molecular formula C7F12S and a molecular weight of 344.12 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,2-bis(trifluoromethyl)thiirane.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,2-bis(trifluoromethyl)thiirane |
|---|---|
| PubChem CID | 23234849 |
| Molecular Formula | C7F12S |
| Molecular Weight | 344.12 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,2-bis(trifluoromethyl)thiirane |
| SMILES | FC(F)(F)C(=C1SC1(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7F12S/c8-4(9,10)1(5(11,12)13)2-3(20-2,6(14,15)16)7(17,18)19 |
| InChIKey | VRWPNQSNTCPMAW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.12 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|