C14H11N3O3 — CID 142648858
3-amino-4-(quinolin-2-ylmethoxyamino)cyclobut-3-ene-1,2-dione (PubChem CID 142648858) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 3-amino-4-(quinolin-2-ylmethoxyamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-(quinolin-2-ylmethoxyamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142648858 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 3-amino-4-(quinolin-2-ylmethoxyamino)cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(NOCc2ccc3ccccc3n2)c(=O)c1=O |
| InChI | InChI=1S/C14H11N3O3/c15-11-12(14(19)13(11)18)17-20-7-9-6-5-8-3-1-2-4-10(8)16-9/h1-6,17H,7,15H2 |
| InChIKey | RPCKEBWBRCKJHJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|