C19H26O6 — CID 142649466
[(2S)-1,2,9-trihydroxy-10-(4-methoxyphenyl)dec-6-yn-5-yl] acetate (PubChem CID 142649466) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(2S)-1,2,9-trihydroxy-10-(4-methoxyphenyl)dec-6-yn-5-yl] acetate.
| Compound Name | [(2S)-1,2,9-trihydroxy-10-(4-methoxyphenyl)dec-6-yn-5-yl] acetate |
|---|---|
| PubChem CID | 142649466 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(2S)-1,2,9-trihydroxy-10-(4-methoxyphenyl)dec-6-yn-5-yl] acetate |
| SMILES | COc1ccc(CC(O)CC#CC(CC[C@H](O)CO)OC(C)=O)cc1 |
| InChI | InChI=1S/C19H26O6/c1-14(21)25-19(11-8-17(23)13-20)5-3-4-16(22)12-15-6-9-18(24-2)10-7-15/h6-7,9-10,16-17,19-20,22-23H,4,8,11-13H2,1-2H3/t16?,17-,19?/m0/s1 |
| InChIKey | FSBHSFMLSYPKJQ-HFCFLWKCSA-N |
| XLogP | 1.06 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|