C25H23N5O7 — CID 142650641
2-morpholin-4-ylethyl 9-[(2,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate (PubChem CID 142650641) has the molecular formula C25H23N5O7 and a molecular weight of 505.49 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 9-[(2,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | 2-morpholin-4-ylethyl 9-[(2,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 142650641 |
| Molecular Formula | C25H23N5O7 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 2-morpholin-4-ylethyl 9-[(2,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
| SMILES | O=C(OCCN1CCOCC1)c1cc2c3ccccc3n(Cc3cc([N+](=O)[O-])ccc3[N+](=O)[O-])c2cn1 |
| InChI | InChI=1S/C25H23N5O7/c31-25(37-12-9-27-7-10-36-11-8-27)21-14-20-19-3-1-2-4-23(19)28(24(20)15-26-21)16-17-13-18(29(32)33)5-6-22(17)30(34)35/h1-6,13-15H,7-12,16H2 |
| InChIKey | JZUPTAYUNVYNRY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 142.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|