C24H28F2 — CID 142651210
5,6-difluoro-5-[(E)-hept-1-enyl]-2-[2-(4-propylphenyl)ethynyl]cyclohexa-1,3-diene (PubChem CID 142651210) has the molecular formula C24H28F2 and a molecular weight of 354.48 g/mol. Its IUPAC name is 5,6-difluoro-5-[(E)-hept-1-enyl]-2-[2-(4-propylphenyl)ethynyl]cyclohexa-1,3-diene.
| Compound Name | 5,6-difluoro-5-[(E)-hept-1-enyl]-2-[2-(4-propylphenyl)ethynyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142651210 |
| Molecular Formula | C24H28F2 |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 5,6-difluoro-5-[(E)-hept-1-enyl]-2-[2-(4-propylphenyl)ethynyl]cyclohexa-1,3-diene |
| SMILES | CCCCC/C=C/C1(F)C=CC(C#Cc2ccc(CCC)cc2)=CC1F |
| InChI | InChI=1S/C24H28F2/c1-3-5-6-7-8-17-24(26)18-16-22(19-23(24)25)15-14-21-12-10-20(9-4-2)11-13-21/h8,10-13,16-19,23H,3-7,9H2,1-2H3/b17-8+ |
| InChIKey | WLBPJQLFEHUAGH-CAOOACKPSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|