C25H25ClN4O4 — CID 142653946
[2-[3-[(3-chloro-4-methoxyphenyl)methyl]-5-cyano-2-oxobenzimidazol-1-yl]-6-cyanohexyl] acetate (PubChem CID 142653946) has the molecular formula C25H25ClN4O4 and a molecular weight of 480.95 g/mol. Its IUPAC name is [2-[3-[(3-chloro-4-methoxyphenyl)methyl]-5-cyano-2-oxobenzimidazol-1-yl]-6-cyanohexyl] acetate.
| Compound Name | [2-[3-[(3-chloro-4-methoxyphenyl)methyl]-5-cyano-2-oxobenzimidazol-1-yl]-6-cyanohexyl] acetate |
|---|---|
| PubChem CID | 142653946 |
| Molecular Formula | C25H25ClN4O4 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [2-[3-[(3-chloro-4-methoxyphenyl)methyl]-5-cyano-2-oxobenzimidazol-1-yl]-6-cyanohexyl] acetate |
| SMILES | COc1ccc(Cn2c(=O)n(C(CCCCC#N)COC(C)=O)c3ccc(C#N)cc32)cc1Cl |
| InChI | InChI=1S/C25H25ClN4O4/c1-17(31)34-16-20(6-4-3-5-11-27)30-22-9-7-18(14-28)13-23(22)29(25(30)32)15-19-8-10-24(33-2)21(26)12-19/h7-10,12-13,20H,3-6,15-16H2,1-2H3 |
| InChIKey | XSUDSLRORDJAAI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 110.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|