C25H26ClN3O4 — CID 70017010
3-[(3-chloro-4-methoxyphenyl)methyl]-1-[3-(1,1-dihydroxypropan-2-ylidene)cyclohexyl]-2-oxobenzimidazole-5-carbonitrile (PubChem CID 70017010) has the molecular formula C25H26ClN3O4 and a molecular weight of 467.95 g/mol. Its IUPAC name is 3-[(3-chloro-4-methoxyphenyl)methyl]-1-[3-(1,1-dihydroxypropan-2-ylidene)cyclohexyl]-2-oxobenzimidazole-5-carbonitrile.
| Compound Name | 3-[(3-chloro-4-methoxyphenyl)methyl]-1-[3-(1,1-dihydroxypropan-2-ylidene)cyclohexyl]-2-oxobenzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 70017010 |
| Molecular Formula | C25H26ClN3O4 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 3-[(3-chloro-4-methoxyphenyl)methyl]-1-[3-(1,1-dihydroxypropan-2-ylidene)cyclohexyl]-2-oxobenzimidazole-5-carbonitrile |
| SMILES | COc1ccc(Cn2c(=O)n(C3CCCC(=C(C)C(O)O)C3)c3ccc(C#N)cc32)cc1Cl |
| InChI | InChI=1S/C25H26ClN3O4/c1-15(24(30)31)18-4-3-5-19(12-18)29-21-8-6-16(13-27)11-22(21)28(25(29)32)14-17-7-9-23(33-2)20(26)10-17/h6-11,19,24,30-31H,3-5,12,14H2,1-2H3 |
| InChIKey | GHOWEUPHEFMTOX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|