C13H11NO5 — CID 142654741
3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile (PubChem CID 142654741) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile.
| Compound Name | 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 142654741 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile |
| SMILES | COC1(OC)OC(=O)C=C(c2cccc(C#N)c2)O1 |
| InChI | InChI=1S/C13H11NO5/c1-16-13(17-2)18-11(7-12(15)19-13)10-5-3-4-9(6-10)8-14/h3-7H,1-2H3 |
| InChIKey | QQWLGXSULGAUAV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|