About 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile
3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile (PubChem CID 142654741) has the molecular formula C13H11NO5
and a molecular weight of 261.23 g/mol. Its IUPAC name is 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile |
| PubChem CID | 142654741 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile |
| SMILES | COC1(OC)OC(=O)C=C(c2cccc(C#N)c2)O1 |
| InChI | InChI=1S/C13H11NO5/c1-16-13(17-2)18-11(7-12(15)19-13)10-5-3-4-9(6-10)8-14/h3-7H,1-2H3 |
| InChIKey | QQWLGXSULGAUAV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile?
The IUPAC name of 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile (CID 142654741) is 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile.
What is the SMILES notation for 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile?
The canonical SMILES for 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile is COC1(OC)OC(=O)C=C(c2cccc(C#N)c2)O1.
What is the InChIKey of 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile?
The InChIKey is QQWLGXSULGAUAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO5/c1-16-13(17-2)18-11(7-12(15)19-13)10-5-3-4-9(6-10)8-14/h3-7H,1-2H3.
What are the key properties of 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile?
3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile has a molecular weight of 261.23 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethoxy-6-oxo-1,3-dioxin-4-yl)benzonitrile is sourced from PubChem (CID 142654741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).