C21H23N2O4+ — CID 1426553
methyl 2,3-dimethoxy-6-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]benzoate (PubChem CID 1426553) has the molecular formula C21H23N2O4+ and a molecular weight of 367.43 g/mol. Its IUPAC name is methyl 2,3-dimethoxy-6-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]benzoate.
| Compound Name | methyl 2,3-dimethoxy-6-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]benzoate |
|---|---|
| PubChem CID | 1426553 |
| Molecular Formula | C21H23N2O4+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | methyl 2,3-dimethoxy-6-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]benzoate |
| SMILES | COC(=O)c1c([C@@H]2[NH2+]CCc3c2[nH]c2ccccc32)ccc(OC)c1OC |
| InChI | InChI=1S/C21H22N2O4/c1-25-16-9-8-14(17(20(16)26-2)21(24)27-3)18-19-13(10-11-22-18)12-6-4-5-7-15(12)23-19/h4-9,18,22-23H,10-11H2,1-3H3/p+1/t18-/m0/s1 |
| InChIKey | REDNPXCPWFQVLT-SFHVURJKSA-O |
| XLogP | 2.18 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|