C20H21N2O3+ — CID 3308973
methyl 1-(2-methoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate (PubChem CID 3308973) has the molecular formula C20H21N2O3+ and a molecular weight of 337.40 g/mol. Its IUPAC name is methyl 1-(2-methoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate.
| Compound Name | methyl 1-(2-methoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 3308973 |
| Molecular Formula | C20H21N2O3+ |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | methyl 1-(2-methoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)C(c2ccccc2OC)[NH2+]1 |
| InChI | InChI=1S/C20H20N2O3/c1-24-17-10-6-4-8-13(17)18-19-14(11-16(22-18)20(23)25-2)12-7-3-5-9-15(12)21-19/h3-10,16,18,21-22H,11H2,1-2H3/p+1 |
| InChIKey | HEJJVRDMWRVRCQ-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|