C17H17N2O2S+ — CID 7047033
methyl (1S,3S)-1-thiophen-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate (PubChem CID 7047033) has the molecular formula C17H17N2O2S+ and a molecular weight of 313.40 g/mol. Its IUPAC name is methyl (1S,3S)-1-thiophen-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate.
| Compound Name | methyl (1S,3S)-1-thiophen-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 7047033 |
| Molecular Formula | C17H17N2O2S+ |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | methyl (1S,3S)-1-thiophen-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2cccs2)[NH2+]1 |
| InChI | InChI=1S/C17H16N2O2S/c1-21-17(20)13-9-11-10-5-2-3-6-12(10)18-15(11)16(19-13)14-7-4-8-22-14/h2-8,13,16,18-19H,9H2,1H3/p+1/t13-,16+/m0/s1 |
| InChIKey | KYUMJWNDZQTKTB-XJKSGUPXSA-O |
| XLogP | 1.98 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|