C20H19N2O4+ — CID 4264750
1-(4-methoxycarbonylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylic acid (PubChem CID 4264750) has the molecular formula C20H19N2O4+ and a molecular weight of 351.38 g/mol. Its IUPAC name is 1-(4-methoxycarbonylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylic acid.
| Compound Name | 1-(4-methoxycarbonylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 4264750 |
| Molecular Formula | C20H19N2O4+ |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-(4-methoxycarbonylphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylic acid |
| SMILES | COC(=O)c1ccc(C2[NH2+]C(C(=O)O)Cc3c2[nH]c2ccccc32)cc1 |
| InChI | InChI=1S/C20H18N2O4/c1-26-20(25)12-8-6-11(7-9-12)17-18-14(10-16(22-17)19(23)24)13-4-2-3-5-15(13)21-18/h2-9,16-17,21-22H,10H2,1H3,(H,23,24)/p+1 |
| InChIKey | LGZGOHXTBJSWFV-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 96.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|