C14H20N2O6S — CID 142657183
ethyl N-acetyl-N-[(1S)-1-(4-methoxy-3-sulfamoylphenyl)ethyl]carbamate (PubChem CID 142657183) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is ethyl N-acetyl-N-[(1S)-1-(4-methoxy-3-sulfamoylphenyl)ethyl]carbamate.
| Compound Name | ethyl N-acetyl-N-[(1S)-1-(4-methoxy-3-sulfamoylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 142657183 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | ethyl N-acetyl-N-[(1S)-1-(4-methoxy-3-sulfamoylphenyl)ethyl]carbamate |
| SMILES | CCOC(=O)N(C(C)=O)[C@@H](C)c1ccc(OC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H20N2O6S/c1-5-22-14(18)16(10(3)17)9(2)11-6-7-12(21-4)13(8-11)23(15,19)20/h6-9H,5H2,1-4H3,(H2,15,19,20)/t9-/m0/s1 |
| InChIKey | HXASOYPTCZLQNB-VIFPVBQESA-N |
| XLogP | 1.41 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |