C15H16N2O2 — CID 14265735
9-benzoyl-1,2,3,4,5,8-hexahydropyrrolo[1,2-a][1,3]diazepin-7-one (PubChem CID 14265735) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 9-benzoyl-1,2,3,4,5,8-hexahydropyrrolo[1,2-a][1,3]diazepin-7-one.
| Compound Name | 9-benzoyl-1,2,3,4,5,8-hexahydropyrrolo[1,2-a][1,3]diazepin-7-one |
|---|---|
| PubChem CID | 14265735 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 9-benzoyl-1,2,3,4,5,8-hexahydropyrrolo[1,2-a][1,3]diazepin-7-one |
| SMILES | O=C(C1=C2NCCCCN2C(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O2/c18-13-10-12(14(19)11-6-2-1-3-7-11)15-16-8-4-5-9-17(13)15/h1-3,6-7,16H,4-5,8-10H2 |
| InChIKey | TYFPSMDPKBYZHF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |