C16H18N2O2 — CID 14265736
9-(4-methylbenzoyl)-1,2,3,4,5,8-hexahydropyrrolo[1,2-a][1,3]diazepin-7-one (PubChem CID 14265736) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 9-(4-methylbenzoyl)-1,2,3,4,5,8-hexahydropyrrolo[1,2-a][1,3]diazepin-7-one.
| Compound Name | 9-(4-methylbenzoyl)-1,2,3,4,5,8-hexahydropyrrolo[1,2-a][1,3]diazepin-7-one |
|---|---|
| PubChem CID | 14265736 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 9-(4-methylbenzoyl)-1,2,3,4,5,8-hexahydropyrrolo[1,2-a][1,3]diazepin-7-one |
| SMILES | Cc1ccc(C(=O)C2=C3NCCCCN3C(=O)C2)cc1 |
| InChI | InChI=1S/C16H18N2O2/c1-11-4-6-12(7-5-11)15(20)13-10-14(19)18-9-3-2-8-17-16(13)18/h4-7,17H,2-3,8-10H2,1H3 |
| InChIKey | HUKXJWOFILBABD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |